![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | P.O.W/ | 2025-06-30 23:44 | - | |
| P.R.E.S.T.A.V.B.A/ | 2025-06-30 23:44 | - | |
| PCB Paranoia/ | 2025-06-30 23:44 | - | |
| PMG-Ukazka/ | 2025-06-30 23:44 | - | |
| Pac Man/ | 2025-06-30 23:44 | - | |
| Pac Munch Jr/ | 2025-06-30 23:44 | - | |
| Pac-Invaders/ | 2025-06-30 23:44 | - | |
| Pac-Mac/ | 2025-06-30 23:44 | - | |
| Pac-Mad/ | 2025-06-30 23:44 | - | |
| Pac-Man (1982)/ | 2025-06-30 23:44 | - | |
| Pac-Man (Sar-An Computer Products)/ | 2025-06-30 23:44 | - | |
| Pac-Man Arcade/ | 2025-06-30 23:44 | - | |
| Pac-Man/ | 2025-06-30 23:44 | - | |
| Pac-Txt/ | 2025-06-30 23:44 | - | |
| Paccie (Elwood Software)/ | 2025-06-30 23:44 | - | |
| Paccie/ | 2025-06-30 23:44 | - | |
| Pacemaker/ | 2025-06-30 23:44 | - | |
| Pacific Coast Highway/ | 2025-06-30 23:44 | - | |
| Pack Man/ | 2025-06-30 23:44 | - | |
| Packman/ | 2025-06-30 23:44 | - | |
| Pad/ | 2025-06-30 23:44 | - | |
| Padajici Balvany/ | 2025-06-30 23:44 | - | |
| Paddleship/ | 2025-06-30 23:44 | - | |
| Pairs/ | 2025-06-30 23:44 | - | |
| Pajaki/ | 2025-06-30 23:44 | - | |
| Pajaki II/ | 2025-06-30 23:44 | - | |
| Pająki, pająki/ | 2025-06-30 23:44 | - | |
| Pakmans Brothers Revenge/ | 2025-06-30 23:44 | - | |
| Pamiec/ | 2025-06-30 23:44 | - | |
| Pandemonium/ | 2025-06-30 23:44 | - | |
| Pang (ASF)/ | 2025-06-30 23:44 | - | |
| Pang (TeBe - Vidol - Ooz - Rocky - stRing)/ | 2025-06-30 23:44 | - | |
| Panga Ponga/ | 2025-06-30 23:44 | - | |
| Pani Basia z Klatki B/ | 2025-06-30 23:44 | - | |
| Panic Express/ | 2025-06-30 23:44 | - | |
| Panic/ | 2025-06-30 23:44 | - | |
| Panik/ | 2025-06-30 23:44 | - | |
| Panowie i Poddani/ | 2025-06-30 23:44 | - | |
| Panther (Datri Software)/ | 2025-06-30 23:44 | - | |
| Panther (Mastertronic)/ | 2025-06-30 23:44 | - | |
| Panzer Grenadier/ | 2025-06-30 23:44 | - | |
| Panzerschlacht/ | 2025-06-30 23:44 | - | |
| Paper Boy/ | 2025-06-30 23:44 | - | |
| Paper Chase/ | 2025-06-30 23:44 | - | |
| Parachute 2011/ | 2025-06-30 23:44 | - | |
| Parachute/ | 2025-06-30 23:44 | - | |
| Paradise Threat, The/ | 2025-06-30 23:44 | - | |
| Paradox/ | 2025-06-30 23:44 | - | |
| Paragon/ | 2025-06-30 23:44 | - | |
| Parallax/ | 2025-06-30 23:44 | - | |
| Paratrooper/ | 2025-06-30 23:44 | - | |
| Paris in Danger/ | 2025-06-30 23:44 | - | |
| Parodya/ | 2025-06-30 23:44 | - | |
| Parsec XL/ | 2025-06-30 23:44 | - | |
| Party Quiz/ | 2025-06-30 23:44 | - | |
| Pasjans/ | 2025-06-30 23:44 | - | |
| Pastfinder/ | 2025-06-30 23:44 | - | |
| Pathfinder/ | 2025-06-30 23:44 | - | |
| Patience!/ | 2025-06-30 23:44 | - | |
| Patience/ | 2025-06-30 23:44 | - | |
| Patrol Nighthawk One/ | 2025-06-30 23:44 | - | |
| Patrol XAL Alpha/ | 2025-06-30 23:44 | - | |
| Patrol in the Space/ | 2025-06-30 23:44 | - | |
| Patrol/ | 2025-06-30 23:44 | - | |
| Paul Daniels' Magic Adventure/ | 2025-06-30 23:44 | - | |
| Paver/ | 2025-06-30 23:44 | - | |
| Pawn, The v2.3/ | 2025-06-30 23:44 | - | |
| Pay-Off, The/ | 2025-06-30 23:44 | - | |
| Peanut Butter Panic/ | 2025-06-30 23:44 | - | |
| Pegasus/ | 2025-06-30 23:44 | - | |
| Pellotte/ | 2025-06-30 23:44 | - | |
| Pengo/ | 2025-06-30 23:44 | - | |
| Pengon/ | 2025-06-30 23:44 | - | |
| Pensate/ | 2025-06-30 23:44 | - | |
| Pentagram/ | 2025-06-30 23:44 | - | |
| People/ | 2025-06-30 23:44 | - | |
| Periscope Up/ | 2025-06-30 23:44 | - | |
| Perly Orcky'ego/ | 2025-06-30 23:44 | - | |
| Perly Szeherezady/ | 2025-06-30 23:44 | - | |
| Perplexity/ | 2025-06-30 23:44 | - | |
| Perxor/ | 2025-06-30 23:44 | - | |
| Phantasie II/ | 2025-06-30 23:44 | - | |
| Phantasie/ | 2025-06-30 23:44 | - | |
| Phantastic Journey/ | 2025-06-30 23:44 | - | |
| Phantom/ | 2025-06-30 23:44 | - | |
| Pharaoh's Curse/ | 2025-06-30 23:44 | - | |
| Pharaoh's Pyramid/ | 2025-06-30 23:44 | - | |
| Pharoah's Curse/ | 2025-06-30 23:44 | - | |
| Pharoah's Tomb/ | 2025-06-30 23:44 | - | |
| Pheenix/ | 2025-06-30 23:44 | - | |
| Phobos/ | 2025-06-30 23:44 | - | |
| Phoenix Lair/ | 2025-06-30 23:44 | - | |
| Phonix 1/ | 2025-06-30 23:44 | - | |
| Phonix Game, The/ | 2025-06-30 23:44 | - | |
| Photo Finish - Greyhound Racing/ | 2025-06-30 23:44 | - | |
| Picnic Paranoia/ | 2025-06-30 23:44 | - | |
| Pie Hunter/ | 2025-06-30 23:44 | - | |
| Pie-Man/ | 2025-06-30 23:44 | - | |
| Piekiełeczko/ | 2025-06-30 23:44 | - | |
| Piekiełko II/ | 2025-06-30 23:44 | - | |
| Piekiełko/ | 2025-06-30 23:44 | - | |
| Pierwotniaki/ | 2025-06-30 23:44 | - | |
| Pierścień Androidów/ | 2025-06-30 23:44 | - | |
| Piggy Bank/ | 2025-06-30 23:44 | - | |
| Pilka/ | 2025-06-30 23:44 | - | |
| Pillbox/ | 2025-06-30 23:44 | - | |
| Pin 1/ | 2025-06-30 23:44 | - | |
| Pin 3/ | 2025-06-30 23:44 | - | |
| Pin 6/ | 2025-06-30 23:44 | - | |
| Pin II/ | 2025-06-30 23:44 | - | |
| Pinball 3/ | 2025-06-30 23:44 | - | |
| Pinball Construction Set/ | 2025-06-30 23:44 | - | |
| Pinball Monster/ | 2025-06-30 23:44 | - | |
| Ping/ | 2025-06-30 23:44 | - | |
| Pingwinek Idzie do Szkoly/ | 2025-06-30 23:44 | - | |
| Pingwinek/ | 2025-06-30 23:44 | - | |
| Pinhead/ | 2025-06-30 23:44 | - | |
| Pipe Line/ | 2025-06-30 23:44 | - | |
| Pipeline/ | 2025-06-30 23:44 | - | |
| Piper/ | 2025-06-30 23:44 | - | |
| Piramida/ | 2025-06-30 23:44 | - | |
| Piramide/ | 2025-06-30 23:44 | - | |
| Piranha (ALA Software)/ | 2025-06-30 23:44 | - | |
| Piranha (Croudy, John)/ | 2025-06-30 23:44 | - | |
| Pirate!!, The/ | 2025-06-30 23:44 | - | |
| Pirates Cove/ | 2025-06-30 23:44 | - | |
| Pirates of the Barbary Coast/ | 2025-06-30 23:44 | - | |
| Piratsky Ostrov/ | 2025-06-30 23:44 | - | |
| Pitfall II - Lost Caverns/ | 2025-06-30 23:44 | - | |
| Pitfall!/ | 2025-06-30 23:44 | - | |
| Pitstop II/ | 2025-06-30 23:44 | - | |
| Pitstop/ | 2025-06-30 23:44 | - | |
| Piętnastka/ | 2025-06-30 23:44 | - | |
| Pixeroids/ | 2025-06-30 23:44 | - | |
| Pięć Gówien Eepcha/ | 2025-06-30 23:44 | - | |
| Piłkarski Poker/ | 2025-06-30 23:44 | - | |
| Plague Attack/ | 2025-06-30 23:44 | - | |
| Plan B/ | 2025-06-30 23:44 | - | |
| Planet Attack/ | 2025-06-30 23:44 | - | |
| Planet Miners/ | 2025-06-30 23:44 | - | |
| Planet of Doom/ | 2025-06-30 23:44 | - | |
| Planeta Caco/ | 2025-06-30 23:44 | - | |
| Planeta Caco II/ | 2025-06-30 23:44 | - | |
| Planetary Defense/ | 2025-06-30 23:44 | - | |
| Planetfall/ | 2025-06-30 23:44 | - | |
| Planets/ | 2025-06-30 23:44 | - | |
| Plant Panic/ | 2025-06-30 23:44 | - | |
| Plantation/ | 2025-06-30 23:44 | - | |
| Plaque Man/ | 2025-06-30 23:44 | - | |
| Plastron/ | 2025-06-30 23:44 | - | |
| Plate Arts/ | 2025-06-30 23:44 | - | |
| Platforms/ | 2025-06-30 23:44 | - | |
| Platoon/ | 2025-06-30 23:44 | - | |
| PlatterMania/ | 2025-06-30 23:44 | - | |
| Play Bandit/ | 2025-06-30 23:44 | - | |
| Playful Professor - Math Tutor/ | 2025-06-30 23:44 | - | |
| Ples Upiru/ | 2025-06-30 23:44 | - | |
| Plop/ | 2025-06-30 23:44 | - | |
| Plot's/ | 2025-06-30 23:44 | - | |
| Plot/ | 2025-06-30 23:44 | - | |
| Plundered Hearts/ | 2025-06-30 23:44 | - | |
| Podfuk II/ | 2025-06-30 23:44 | - | |
| Podraz III/ | 2025-06-30 23:44 | - | |
| Podraz IV/ | 2025-06-30 23:44 | - | |
| Podraz/ | 2025-06-30 23:44 | - | |
| Podraz V/ | 2025-06-30 23:44 | - | |
| Podroz w Czasie II/ | 2025-06-30 23:44 | - | |
| Podroze po Polsce/ | 2025-06-30 23:44 | - | |
| Podroz w Czasie/ | 2025-06-30 23:44 | - | |
| Podz, The/ | 2025-06-30 23:44 | - | |
| Podziemia/ | 2025-06-30 23:44 | - | |
| Pogan/ | 2025-06-30 23:44 | - | |
| Pogo Joe/ | 2025-06-30 23:44 | - | |
| Pogoman/ | 2025-06-30 23:44 | - | |
| Pohadkova Zeme/ | 2025-06-30 23:44 | - | |
| Point of View/ | 2025-06-30 23:44 | - | |
| Poker Dice/ | 2025-06-30 23:44 | - | |
| Poker Solitaire/ | 2025-06-30 23:44 | - | |
| Poker Tourney/ | 2025-06-30 23:44 | - | |
| PokerSAM/ | 2025-06-30 23:44 | - | |
| Polar Explorer/ | 2025-06-30 23:44 | - | |
| Polar Pierre/ | 2025-06-30 23:44 | - | |
| Polaris/ | 2025-06-30 23:44 | - | |
| Polcon 2013/ | 2025-06-30 23:44 | - | |
| Pole Minowe/ | 2025-06-30 23:44 | - | |
| Pole Minowe II/ | 2025-06-30 23:44 | - | |
| Pole Position Race Designer v3.01/ | 2025-06-30 23:44 | - | |
| Pole Position X+/ | 2025-06-30 23:44 | - | |
| Pole Position X/ | 2025-06-30 23:44 | - | |
| Pole Position/ | 2025-06-30 23:44 | - | |
| Polish Game Robbo/ | 2025-06-30 23:44 | - | |
| Polowanie na malpe/ | 2025-06-30 23:44 | - | |
| Polygons!/ | 2025-06-30 23:44 | - | |
| Pomsta Sileneho Ataristy/ | 2025-06-30 23:44 | - | |
| Pomsta Sinclairistum/ | 2025-06-30 23:44 | - | |
| Pond, The/ | 2025-06-30 23:44 | - | |
| Pondering About Max's/ | 2025-06-30 23:44 | - | |
| Pong (Analog Computing)/ | 2025-06-30 23:44 | - | |
| Pong (Champagne, Robert)/ | 2025-06-30 23:44 | - | |
| Pong (Husak, Jakub)/ | 2025-06-30 23:44 | - | |
| Pong (Mirage)/ | 2025-06-30 23:44 | - | |
| Pong (unknown 1)/ | 2025-06-30 23:44 | - | |
| Pong (unknown 2)/ | 2025-06-30 23:44 | - | |
| Pong!/ | 2025-06-30 23:44 | - | |
| Pongblast/ | 2025-06-30 23:44 | - | |
| Pongo/ | 2025-06-30 23:44 | - | |
| Pontoon!/ | 2025-06-30 23:44 | - | |
| Pooka Pinball/ | 2025-06-30 23:44 | - | |
| Pool 1.5/ | 2025-06-30 23:44 | - | |
| Pool 400/ | 2025-06-30 23:44 | - | |
| Pool/ | 2025-06-30 23:44 | - | |
| Poor Ball!/ | 2025-06-30 23:44 | - | |
| Pooyan/ | 2025-06-30 23:44 | - | |
| Pop-N-Rocker/ | 2025-06-30 23:44 | - | |
| Popcorn!/ | 2025-06-30 23:44 | - | |
| Popeye Pinball/ | 2025-06-30 23:44 | - | |
| Popeye/ | 2025-06-30 23:44 | - | |
| Porky's/ | 2025-06-30 23:44 | - | |
| Pornopoly/ | 2025-06-30 23:44 | - | |
| Posthelper/ | 2025-06-30 23:44 | - | |
| Postman/ | 2025-06-30 23:44 | - | |
| Poszukiwacze/ | 2025-06-30 23:44 | - | |
| Pothole Pete/ | 2025-06-30 23:44 | - | |
| Potion, The/ | 2025-06-30 23:44 | - | |
| Potluck/ | 2025-06-30 23:44 | - | |
| Poussinet/ | 2025-06-30 23:44 | - | |
| Power Down/ | 2025-06-30 23:44 | - | |
| Powerpath/ | 2025-06-30 23:44 | - | |
| Powerstar/ | 2025-06-30 23:44 | - | |
| Poznaj Swoj Kraj/ | 2025-06-30 23:44 | - | |
| Pqr I/ | 2025-06-30 23:44 | - | |
| Pqr II/ | 2025-06-30 23:44 | - | |
| Predator/ | 2025-06-30 23:44 | - | |
| Prehistoric/ | 2025-06-30 23:44 | - | |
| Preppie! II/ | 2025-06-30 23:44 | - | |
| Preppie!/ | 2025-06-30 23:44 | - | |
| Pribeh Ze Tmy/ | 2025-06-30 23:44 | - | |
| Price is Right, The/ | 2025-06-30 23:44 | - | |
| Price of Magik, The/ | 2025-06-30 23:44 | - | |
| Princess and the Frog, The/ | 2025-06-30 23:44 | - | |
| Prisoner/ | 2025-06-30 23:44 | - | |
| Prizrak Nuly/ | 2025-06-30 23:44 | - | |
| Pro Mountain Bike Simulator/ | 2025-06-30 23:44 | - | |
| Pro Tour Golf/ | 2025-06-30 23:44 | - | |
| Probe One - The Transmitter/ | 2025-06-30 23:44 | - | |
| Problem Jasia/ | 2025-06-30 23:44 | - | |
| Prochazka V C/ | 2025-06-30 23:44 | - | |
| Procrastination/ | 2025-06-30 23:44 | - | |
| Profesional Killers/ | 2025-06-30 23:44 | - | |
| Professional Killers II (S.K. Wizards)/ | 2025-06-30 23:44 | - | |
| Professional Killers II/ | 2025-06-30 23:44 | - | |
| Professional Roulette/ | 2025-06-30 23:44 | - | |
| Professor I.Q/ | 2025-06-30 23:44 | - | |
| Progolf/ | 2025-06-30 23:44 | - | |
| Project Fire Blast - The Battle of Zegadon/ | 2025-06-30 23:44 | - | |
| Project Xanthien/ | 2025-06-30 23:44 | - | |
| Project-M/ | 2025-06-30 23:44 | - | |
| Protector (Mastertronic)/ | 2025-06-30 23:44 | - | |
| Protector (Synapse Software)/ | 2025-06-30 23:44 | - | |
| Protector II/ | 2025-06-30 23:44 | - | |
| Prudent Dactyl II/ | 2025-06-30 23:44 | - | |
| Prudent Dactyl III/ | 2025-06-30 23:44 | - | |
| Prudent Dactyl/ | 2025-06-30 23:44 | - | |
| Pruters/ | 2025-06-30 23:44 | - | |
| Przekladanka/ | 2025-06-30 23:44 | - | |
| Przemytnik/ | 2025-06-30 23:44 | - | |
| Przygody z Cyferkami/ | 2025-06-30 23:44 | - | |
| Puc-Muc!/ | 2025-06-30 23:44 | - | |
| Pungo/ | 2025-06-30 23:44 | - | |
| Pungoland!/ | 2025-06-30 23:44 | - | |
| Pushky/ | 2025-06-30 23:44 | - | |
| Pushover/ | 2025-06-30 23:44 | - | |
| Pushy Pig/ | 2025-06-30 23:44 | - | |
| Pussy Galore/ | 2025-06-30 23:44 | - | |
| Puzmania (Fire-Bird)/ | 2025-06-30 23:44 | - | |
| Puzmania (Sal)/ | 2025-06-30 23:44 | - | |
| Puzzle Construction Set/ | 2025-06-30 23:44 | - | |
| Puzzle Gates of the Incas/ | 2025-06-30 23:44 | - | |
| Puzzle Mania/ | 2025-06-30 23:44 | - | |
| Puzzle/ | 2025-06-30 23:44 | - | |
| Puzzle Pleasure/ | 2025-06-30 23:44 | - | |
| PuzzlePanic/ | 2025-06-30 23:44 | - | |
| Puzzler, The/ | 2025-06-30 23:44 | - | |
| Puzzlito/ | 2025-06-30 23:44 | - | |
| Pyramid Run/ | 2025-06-30 23:44 | - | |
| Pyramid/ | 2025-06-30 23:44 | - | |
| Pyramida/ | 2025-06-30 23:44 | - | |
| Pyramidos/ | 2025-06-30 23:44 | - | |
| Pyromania/ | 2025-06-30 23:44 | - | |
|
|---|