![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Molecule Man Maze Editor, The (19xx)(Mastertronic)(US)[a1].xex | 2025-07-02 13:35 | 7.4K | |
| Molecule Man Maze Editor, The (19xx)(Mastertronic)(US)[a].xex | 2025-07-02 13:35 | 8.1K | |
| Molecule Man Maze Editor, The (19xx)(Mastertronic)(US).atr | 2025-07-02 13:35 | 8.3K | |
| Molecule Man Maze Editor, The (19xx)(Mastertronic)(US).xex | 2025-07-02 13:35 | 12K | |
| Molecule Man (1986)(Mastertronic)(GB)[a2].xex | 2025-07-02 13:35 | 27K | |
| Molecule Man (1986)(Mastertronic)(GB)[a1].xex | 2025-07-02 13:35 | 34K | |
| Molecule Man (1986)(Mastertronic)(GB)[a].xex | 2025-07-02 13:35 | 35K | |
| Molecule Man (1986)(Mastertronic)(GB).xex | 2025-07-02 13:35 | 37K | |
| Molecule Man & Maze Editor (1986)(Mastertronic)(GB)[h Atari Boys].atr | 2025-07-02 13:35 | 90K | |
| Molecule Man (1986)(Mastertronic)(GB).atr | 2025-07-02 13:35 | 90K | |